TheoremComplete

The Chinese Remainder Theorem

The Chinese Remainder Theorem decomposes quotient rings along comaximal ideals, providing the algebraic foundation for modular arithmetic and more general ring decompositions.


Statement

Theorem4.5Chinese remainder theorem (general form)

Let RR be a commutative ring and I1,,InI_1, \ldots, I_n ideals that are pairwise comaximal: Ij+Ik=RI_j + I_k = R for all jkj \neq k. Then:

  1. I1I2In=I1I2InI_1 \cap I_2 \cap \cdots \cap I_n = I_1 I_2 \cdots I_n.
  2. The natural map φ:RR/I1×R/I2××R/In\varphi: R \to R/I_1 \times R/I_2 \times \cdots \times R/I_n given by r(r+I1,,r+In)r \mapsto (r + I_1, \ldots, r + I_n) is surjective with kernel I1InI_1 \cap \cdots \cap I_n. Hence:

R/(I1In)R/I1××R/In.R/(I_1 \cap \cdots \cap I_n) \cong R/I_1 \times \cdots \times R/I_n.


Proof

Proof

Case n=2n = 2: Since I1+I2=RI_1 + I_2 = R, write 1=a+b1 = a + b with aI1a \in I_1, bI2b \in I_2.

Surjectivity: Given (r1+I1,r2+I2)(r_1 + I_1, r_2 + I_2), the element r=r1b+r2ar = r_1 b + r_2 a satisfies rr1(modI1)r \equiv r_1 \pmod{I_1} (since aI1a \in I_1, b=1ab = 1 - a, so r1br1r_1 b \equiv r_1) and rr2(modI2)r \equiv r_2 \pmod{I_2} (similarly).

Kernel: ker(φ)=I1I2\ker(\varphi) = I_1 \cap I_2. We show I1I2=I1I2I_1 \cap I_2 = I_1 I_2. Always I1I2I1I2I_1 I_2 \subseteq I_1 \cap I_2. Conversely, if cI1I2c \in I_1 \cap I_2, then c=c1=c(a+b)=ca+cbI2I1+I1I2=I1I2c = c \cdot 1 = c(a + b) = ca + cb \in I_2 I_1 + I_1 I_2 = I_1 I_2.

Induction for n>2n > 2: We show I1I_1 and I2InI_2 \cap \cdots \cap I_n are comaximal. For each k2k \geq 2, we have ak+bk=1a_k + b_k = 1 with akI1a_k \in I_1, bkIkb_k \in I_k. Then k=2nbkI2InI2In\prod_{k=2}^{n} b_k \in I_2 \cdots I_n \subseteq I_2 \cap \cdots \cap I_n, and 1bk=1(1ak)I11 - \prod b_k = 1 - \prod(1-a_k) \in I_1. So I1+(I2In)=RI_1 + (I_2 \cap \cdots \cap I_n) = R, and we apply the n=2n = 2 case. \blacksquare


Applications

ExampleApplications of CRT
  1. Classical CRT: Z/mnZZ/mZ×Z/nZ\mathbb{Z}/mn\mathbb{Z} \cong \mathbb{Z}/m\mathbb{Z} \times \mathbb{Z}/n\mathbb{Z} when gcd(m,n)=1\gcd(m,n) = 1. This gives the structure of (Z/nZ)×(\mathbb{Z}/n\mathbb{Z})^\times: φ(n)=φ(piei)\varphi(n) = \prod \varphi(p_i^{e_i}).

  2. Structure of finite abelian groups: Via the CRT applied to Z\mathbb{Z}-modules, every finitely generated abelian group decomposes as Z/diZZr\bigoplus \mathbb{Z}/d_i\mathbb{Z} \oplus \mathbb{Z}^r.

  3. Polynomial interpolation: In k[x]k[x]: the ideals (xa1),,(xan)(x - a_1), \ldots, (x - a_n) are comaximal for distinct aia_i. CRT gives k[x]/(xai)knk[x]/\prod(x-a_i) \cong k^n, recovering Lagrange interpolation.

RemarkNon-commutative and sheaf-theoretic generalizations

In algebraic geometry, the CRT globalizes to the sheaf condition: a sheaf is determined by its local sections, which must agree on overlaps. The CRT for rings is the affine case of this principle. In non-commutative algebra, analogous decomposition results hold for semisimple rings (Artin-Wedderburn theorem).